About 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one
3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one (PubChem CID 63605892) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one.
Molecular Properties
| Compound Name | 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one |
| PubChem CID | 63605892 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one |
| SMILES | Cc1cc(C)c(C(=O)N2CCNC(=O)C2C)c(C)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-9-7-10(2)13(11(3)8-9)15(19)17-6-5-16-14(18)12(17)4/h7-8,12H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | TYBDKDZYDSXYSA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one?
The IUPAC name of 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one (CID 63605892) is 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one.
What is the SMILES notation for 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one?
The canonical SMILES for 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one is Cc1cc(C)c(C(=O)N2CCNC(=O)C2C)c(C)c1.
What is the InChIKey of 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one?
The InChIKey is TYBDKDZYDSXYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-9-7-10(2)13(11(3)8-9)15(19)17-6-5-16-14(18)12(17)4/h7-8,12H,5-6H2,1-4H3,(H,16,18).
What are the key properties of 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one?
3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one has a molecular weight of 260.34 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(2,4,6-trimethylbenzoyl)piperazin-2-one is sourced from PubChem (CID 63605892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).