C17H19N3O2 — CID 46994284
4-(2,6-dimethylquinoline-3-carbonyl)-3-methylpiperazin-2-one (PubChem CID 46994284) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-(2,6-dimethylquinoline-3-carbonyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(2,6-dimethylquinoline-3-carbonyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 46994284 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(2,6-dimethylquinoline-3-carbonyl)-3-methylpiperazin-2-one |
| SMILES | Cc1ccc2nc(C)c(C(=O)N3CCNC(=O)C3C)cc2c1 |
| InChI | InChI=1S/C17H19N3O2/c1-10-4-5-15-13(8-10)9-14(11(2)19-15)17(22)20-7-6-18-16(21)12(20)3/h4-5,8-9,12H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | JJBRYQABKWNEHW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |