C23H25N3O — CID 55764274
(2,6-dimethylquinolin-3-yl)-(2-pyridin-4-ylazepan-1-yl)methanone (PubChem CID 55764274) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (2,6-dimethylquinolin-3-yl)-(2-pyridin-4-ylazepan-1-yl)methanone.
| Compound Name | (2,6-dimethylquinolin-3-yl)-(2-pyridin-4-ylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 55764274 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (2,6-dimethylquinolin-3-yl)-(2-pyridin-4-ylazepan-1-yl)methanone |
| SMILES | Cc1ccc2nc(C)c(C(=O)N3CCCCCC3c3ccncc3)cc2c1 |
| InChI | InChI=1S/C23H25N3O/c1-16-7-8-21-19(14-16)15-20(17(2)25-21)23(27)26-13-5-3-4-6-22(26)18-9-11-24-12-10-18/h7-12,14-15,22H,3-6,13H2,1-2H3 |
| InChIKey | PGKRPANHAAVBIJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |