C13H12Cl2INO3 — CID 43409924
methyl 1-(3,5-dichloro-2-iodobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 43409924) has the molecular formula C13H12Cl2INO3 and a molecular weight of 428.05 g/mol. Its IUPAC name is methyl 1-(3,5-dichloro-2-iodobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3,5-dichloro-2-iodobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43409924 |
| Molecular Formula | C13H12Cl2INO3 |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | methyl 1-(3,5-dichloro-2-iodobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C13H12Cl2INO3/c1-20-13(19)10-3-2-4-17(10)12(18)8-5-7(14)6-9(15)11(8)16/h5-6,10H,2-4H2,1H3 |
| InChIKey | GHNRVIPPDJGDBG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|