C13H13Cl2NO3 — CID 43410027
methyl 1-(2,3-dichlorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 43410027) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is methyl 1-(2,3-dichlorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2,3-dichlorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43410027 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | methyl 1-(2,3-dichlorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H13Cl2NO3/c1-19-13(18)10-6-3-7-16(10)12(17)8-4-2-5-9(14)11(8)15/h2,4-5,10H,3,6-7H2,1H3 |
| InChIKey | HPYZKBGIEFVSCG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |