C14H15Cl2NO3 — CID 115535937
methyl (2R)-1-(2,6-dichlorobenzoyl)piperidine-2-carboxylate (PubChem CID 115535937) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is methyl (2R)-1-(2,6-dichlorobenzoyl)piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(2,6-dichlorobenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115535937 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | methyl (2R)-1-(2,6-dichlorobenzoyl)piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO3/c1-20-14(19)11-7-2-3-8-17(11)13(18)12-9(15)5-4-6-10(12)16/h4-6,11H,2-3,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | QXJAIGQEWVNWET-LLVKDONJSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |