C16H20ClNO3 — CID 80998275
tert-butyl (2S)-1-(2-chlorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 80998275) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is tert-butyl (2S)-1-(2-chlorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(2-chlorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80998275 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | tert-butyl (2S)-1-(2-chlorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H20ClNO3/c1-16(2,3)21-15(20)13-9-6-10-18(13)14(19)11-7-4-5-8-12(11)17/h4-5,7-8,13H,6,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | UUXBYEPPOOOGSV-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |