C15H19ClN2O3 — CID 80999997
tert-butyl (2R)-1-(6-chloropyridine-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 80999997) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is tert-butyl (2R)-1-(6-chloropyridine-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(6-chloropyridine-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80999997 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | tert-butyl (2R)-1-(6-chloropyridine-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1C(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-15(2,3)21-14(20)11-7-5-9-18(11)13(19)10-6-4-8-12(16)17-10/h4,6,8,11H,5,7,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | SUDLRYRISFUXJQ-LLVKDONJSA-N |
| XLogP | 2.68 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|