C16H21NO4 — CID 115535890
tert-butyl (2R)-1-(4-hydroxybenzoyl)pyrrolidine-2-carboxylate (PubChem CID 115535890) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl (2R)-1-(4-hydroxybenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(4-hydroxybenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115535890 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl (2R)-1-(4-hydroxybenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-16(2,3)21-15(20)13-5-4-10-17(13)14(19)11-6-8-12(18)9-7-11/h6-9,13,18H,4-5,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | LYIVNVPFAFUDAO-CYBMUJFWSA-N |
| XLogP | 2.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |