C15H21NO3S — CID 81004290
tert-butyl (2S)-1-(5-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 81004290) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is tert-butyl (2S)-1-(5-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(5-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 81004290 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | tert-butyl (2S)-1-(5-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C15H21NO3S/c1-10-7-8-12(20-10)13(17)16-9-5-6-11(16)14(18)19-15(2,3)4/h7-8,11H,5-6,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | TUZRMUOXJRZRBD-NSHDSACASA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |