C15H20BrNO3S — CID 80998890
tert-butyl (2S)-1-(5-bromo-4-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 80998890) has the molecular formula C15H20BrNO3S and a molecular weight of 374.30 g/mol. Its IUPAC name is tert-butyl (2S)-1-(5-bromo-4-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(5-bromo-4-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80998890 |
| Molecular Formula | C15H20BrNO3S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | tert-butyl (2S)-1-(5-bromo-4-methylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)sc1Br |
| InChI | InChI=1S/C15H20BrNO3S/c1-9-8-11(21-12(9)16)13(18)17-7-5-6-10(17)14(19)20-15(2,3)4/h8,10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | WJOOXKOSXJAWJX-JTQLQIEISA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |