C16H23NO3S — CID 80998732
tert-butyl (2R)-1-(5-ethylthiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 80998732) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is tert-butyl (2R)-1-(5-ethylthiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(5-ethylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80998732 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | tert-butyl (2R)-1-(5-ethylthiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CCc1ccc(C(=O)N2CCC[C@@H]2C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C16H23NO3S/c1-5-11-8-9-13(21-11)14(18)17-10-6-7-12(17)15(19)20-16(2,3)4/h8-9,12H,5-7,10H2,1-4H3/t12-/m1/s1 |
| InChIKey | XMAZRFUTBMPXRJ-GFCCVEGCSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |