C14H18BrNO3S — CID 81003019
tert-butyl (2R)-1-(5-bromothiophene-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 81003019) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is tert-butyl (2R)-1-(5-bromothiophene-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(5-bromothiophene-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 81003019 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | tert-butyl (2R)-1-(5-bromothiophene-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1C(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C14H18BrNO3S/c1-14(2,3)19-13(18)10-5-4-6-16(10)12(17)9-7-11(15)20-8-9/h7-8,10H,4-6H2,1-3H3/t10-/m1/s1 |
| InChIKey | HUUGFZINJKNEOF-SNVBAGLBSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |