C15H21N3O3 — CID 80999348
tert-butyl (2S)-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 80999348) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl (2S)-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80999348 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl (2S)-1-(5-methylpyrazine-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H21N3O3/c1-10-8-17-11(9-16-10)13(19)18-7-5-6-12(18)14(20)21-15(2,3)4/h8-9,12H,5-7H2,1-4H3/t12-/m0/s1 |
| InChIKey | UNDAEVLZAVBBQE-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |