C12H12Cl2INO2 — CID 79028446
(3,5-dichloro-2-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 79028446) has the molecular formula C12H12Cl2INO2 and a molecular weight of 400.04 g/mol. Its IUPAC name is (3,5-dichloro-2-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3,5-dichloro-2-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 79028446 |
| Molecular Formula | C12H12Cl2INO2 |
| Molecular Weight | 400.04 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | (3,5-dichloro-2-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1I)N1CCC[C@H]1CO |
| InChI | InChI=1S/C12H12Cl2INO2/c13-7-4-9(11(15)10(14)5-7)12(18)16-3-1-2-8(16)6-17/h4-5,8,17H,1-3,6H2/t8-/m0/s1 |
| InChIKey | PJKCJEPZVILLNZ-QMMMGPOBSA-N |
| XLogP | 3.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.04 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|