C12H13BrINO2 — CID 104955450
(2-bromo-5-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 104955450) has the molecular formula C12H13BrINO2 and a molecular weight of 410.05 g/mol. Its IUPAC name is (2-bromo-5-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-bromo-5-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 104955450 |
| Molecular Formula | C12H13BrINO2 |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | (2-bromo-5-iodophenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(I)ccc1Br)N1CCC[C@H]1CO |
| InChI | InChI=1S/C12H13BrINO2/c13-11-4-3-8(14)6-10(11)12(17)15-5-1-2-9(15)7-16/h3-4,6,9,16H,1-2,5,7H2/t9-/m0/s1 |
| InChIKey | UZNHZIFUPZDSCS-VIFPVBQESA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|