C12H12Br2ClNO — CID 114375617
[2-(chloromethyl)pyrrolidin-1-yl]-(2,5-dibromophenyl)methanone (PubChem CID 114375617) has the molecular formula C12H12Br2ClNO and a molecular weight of 381.50 g/mol. Its IUPAC name is [2-(chloromethyl)pyrrolidin-1-yl]-(2,5-dibromophenyl)methanone.
| Compound Name | [2-(chloromethyl)pyrrolidin-1-yl]-(2,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 114375617 |
| Molecular Formula | C12H12Br2ClNO |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | [2-(chloromethyl)pyrrolidin-1-yl]-(2,5-dibromophenyl)methanone |
| SMILES | O=C(c1cc(Br)ccc1Br)N1CCCC1CCl |
| InChI | InChI=1S/C12H12Br2ClNO/c13-8-3-4-11(14)10(6-8)12(17)16-5-1-2-9(16)7-15/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | RGGHKMABURIEFK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|