C12H13Br2N3O2 — CID 114375250
1-(2,5-dibromobenzoyl)-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 114375250) has the molecular formula C12H13Br2N3O2 and a molecular weight of 391.06 g/mol. Its IUPAC name is 1-(2,5-dibromobenzoyl)-N'-hydroxypyrrolidine-2-carboximidamide.
| Compound Name | 1-(2,5-dibromobenzoyl)-N'-hydroxypyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 114375250 |
| Molecular Formula | C12H13Br2N3O2 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | 1-(2,5-dibromobenzoyl)-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CCCN1C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H13Br2N3O2/c13-7-3-4-9(14)8(6-7)12(18)17-5-1-2-10(17)11(15)16-19/h3-4,6,10,19H,1-2,5H2,(H2,15,16) |
| InChIKey | YWRRJIGFAHOVCZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|