C13H16BrN3O3 — CID 107730090
1-(5-bromo-2-hydroxybenzoyl)-N'-hydroxypiperidine-2-carboximidamide (PubChem CID 107730090) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 1-(5-bromo-2-hydroxybenzoyl)-N'-hydroxypiperidine-2-carboximidamide.
| Compound Name | 1-(5-bromo-2-hydroxybenzoyl)-N'-hydroxypiperidine-2-carboximidamide |
|---|---|
| PubChem CID | 107730090 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(5-bromo-2-hydroxybenzoyl)-N'-hydroxypiperidine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CCCCN1C(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H16BrN3O3/c14-8-4-5-11(18)9(7-8)13(19)17-6-2-1-3-10(17)12(15)16-20/h4-5,7,10,18,20H,1-3,6H2,(H2,15,16) |
| InChIKey | WPFQSVZBTSBNBI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|