C13H15BrFNO2 — CID 43421295
(2-bromo-5-fluorophenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 43421295) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (2-bromo-5-fluorophenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 43421295 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-[2-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1Br)N1CCCCC1CO |
| InChI | InChI=1S/C13H15BrFNO2/c14-12-5-4-9(15)7-11(12)13(18)16-6-2-1-3-10(16)8-17/h4-5,7,10,17H,1-3,6,8H2 |
| InChIKey | DMLUQTVXJNHWQJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |