C14H14BrIN2O2 — CID 103280797
1-(2-bromo-5-iodobenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103280797) has the molecular formula C14H14BrIN2O2 and a molecular weight of 449.09 g/mol. Its IUPAC name is 1-(2-bromo-5-iodobenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(2-bromo-5-iodobenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103280797 |
| Molecular Formula | C14H14BrIN2O2 |
| Molecular Weight | 449.09 g/mol |
| Exact Mass | 447.93 |
| IUPAC Name | 1-(2-bromo-5-iodobenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCC2C1CCCN2C(=O)c1cc(I)ccc1Br |
| InChI | InChI=1S/C14H14BrIN2O2/c15-11-4-3-8(16)6-10(11)14(20)18-5-1-2-9-12(18)7-17-13(9)19/h3-4,6,9,12H,1-2,5,7H2,(H,17,19) |
| InChIKey | VDCXAELYLLQQNX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|