C13H13Cl2N3O2 — CID 103354357
1-(2,6-dichloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103354357) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 1-(2,6-dichloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(2,6-dichloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103354357 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-(2,6-dichloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCC2C1CCCN2C(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-10-4-3-8(11(15)17-10)13(20)18-5-1-2-7-9(18)6-16-12(7)19/h3-4,7,9H,1-2,5-6H2,(H,16,19) |
| InChIKey | XJHSLPUSDDGLGT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|