C13H13BrClN3O2 — CID 103195185
1-(5-bromo-2-chloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103195185) has the molecular formula C13H13BrClN3O2 and a molecular weight of 358.62 g/mol. Its IUPAC name is 1-(5-bromo-2-chloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-(5-bromo-2-chloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103195185 |
| Molecular Formula | C13H13BrClN3O2 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 1-(5-bromo-2-chloropyridine-3-carbonyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCC2C1CCCN2C(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C13H13BrClN3O2/c14-7-4-9(11(15)16-5-7)13(20)18-3-1-2-8-10(18)6-17-12(8)19/h4-5,8,10H,1-3,6H2,(H,17,19) |
| InChIKey | WCJQKJAFEOGQNR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|