C15H18BrClN2O — CID 94334915
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromo-2-chloro-3-pyridinyl)methanone (PubChem CID 94334915) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromo-2-chloro-3-pyridinyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromo-2-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 94334915 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromo-2-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cc(Br)cnc1Cl)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H18BrClN2O/c16-11-8-12(14(17)18-9-11)15(20)19-7-3-5-10-4-1-2-6-13(10)19/h8-10,13H,1-7H2/t10-,13-/m1/s1 |
| InChIKey | HXAKGNWREVIBKH-ZWNOBZJWSA-N |
| XLogP | 4.29 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|