C14H17ClN2O — CID 78958423
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-chloro-3-pyridinyl)methanone (PubChem CID 78958423) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-chloro-3-pyridinyl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 78958423 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cccnc1Cl)N1CCC2CCCCC21 |
| InChI | InChI=1S/C14H17ClN2O/c15-13-11(5-3-8-16-13)14(18)17-9-7-10-4-1-2-6-12(10)17/h3,5,8,10,12H,1-2,4,6-7,9H2 |
| InChIKey | DKFJNDHKCLXLRN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|