C13H16ClN3O2 — CID 61052177
1-(2-chloropyridine-3-carbonyl)-N-methylpiperidine-2-carboxamide (PubChem CID 61052177) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 1-(2-chloropyridine-3-carbonyl)-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-(2-chloropyridine-3-carbonyl)-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 61052177 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-(2-chloropyridine-3-carbonyl)-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1C(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c1-15-12(18)10-6-2-3-8-17(10)13(19)9-5-4-7-16-11(9)14/h4-5,7,10H,2-3,6,8H2,1H3,(H,15,18) |
| InChIKey | WLCCVSIECZHBJS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|