C12H14ClN3O2 — CID 60715718
1-(2-chloropyridine-3-carbonyl)piperidine-2-carboxamide (PubChem CID 60715718) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 1-(2-chloropyridine-3-carbonyl)piperidine-2-carboxamide.
| Compound Name | 1-(2-chloropyridine-3-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 60715718 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-(2-chloropyridine-3-carbonyl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)c1cccnc1Cl |
| InChI | InChI=1S/C12H14ClN3O2/c13-10-8(4-3-6-15-10)12(18)16-7-2-1-5-9(16)11(14)17/h3-4,6,9H,1-2,5,7H2,(H2,14,17) |
| InChIKey | IIOCDTHIOOGVEM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|