C10H11ClN2O3 — CID 106685344
1-(2-chlorofuran-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 106685344) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-chlorofuran-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106685344 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1-(2-chlorofuran-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C10H11ClN2O3/c11-8-6(3-5-16-8)10(15)13-4-1-2-7(13)9(12)14/h3,5,7H,1-2,4H2,(H2,12,14) |
| InChIKey | PIQBRXDGYICTTO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |