C14H15Cl2NO2 — CID 47135151
(E)-3-(2,5-dichlorophenyl)-1-(2-methylmorpholin-4-yl)prop-2-en-1-one (PubChem CID 47135151) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-1-(2-methylmorpholin-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-1-(2-methylmorpholin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 47135151 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-1-(2-methylmorpholin-4-yl)prop-2-en-1-one |
| SMILES | CC1CN(C(=O)/C=C/c2cc(Cl)ccc2Cl)CCO1 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-10-9-17(6-7-19-10)14(18)5-2-11-8-12(15)3-4-13(11)16/h2-5,8,10H,6-7,9H2,1H3/b5-2+ |
| InChIKey | FGAICXKNUCRXDW-GORDUTHDSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|