C12H16ClN3O2 — CID 62247369
(5-chloro-2-hydrazinylphenyl)-(2-methylmorpholin-4-yl)methanone (PubChem CID 62247369) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is (5-chloro-2-hydrazinylphenyl)-(2-methylmorpholin-4-yl)methanone.
| Compound Name | (5-chloro-2-hydrazinylphenyl)-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 62247369 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (5-chloro-2-hydrazinylphenyl)-(2-methylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(Cl)ccc2NN)CCO1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-8-7-16(4-5-18-8)12(17)10-6-9(13)2-3-11(10)15-14/h2-3,6,8,15H,4-5,7,14H2,1H3 |
| InChIKey | HDLFGQPXYIJNQM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|