C14H17ClN2O4 — CID 115533261
methyl 2-[4-(2-amino-5-chlorobenzoyl)morpholin-2-yl]acetate (PubChem CID 115533261) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is methyl 2-[4-(2-amino-5-chlorobenzoyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(2-amino-5-chlorobenzoyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 115533261 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 2-[4-(2-amino-5-chlorobenzoyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cc(Cl)ccc2N)CCO1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-20-13(18)7-10-8-17(4-5-21-10)14(19)11-6-9(15)2-3-12(11)16/h2-3,6,10H,4-5,7-8,16H2,1H3 |
| InChIKey | SABYUHHGAXGCRV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|