C16H21NO4 — CID 79812703
methyl 2-[4-(2,4-dimethylbenzoyl)morpholin-2-yl]acetate (PubChem CID 79812703) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 2-[4-(2,4-dimethylbenzoyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(2,4-dimethylbenzoyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79812703 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 2-[4-(2,4-dimethylbenzoyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2ccc(C)cc2C)CCO1 |
| InChI | InChI=1S/C16H21NO4/c1-11-4-5-14(12(2)8-11)16(19)17-6-7-21-13(10-17)9-15(18)20-3/h4-5,8,13H,6-7,9-10H2,1-3H3 |
| InChIKey | FTIHBCHFMNVJLC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |