C14H17NO5 — CID 115534948
methyl 2-[4-(3-hydroxybenzoyl)morpholin-2-yl]acetate (PubChem CID 115534948) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 2-[4-(3-hydroxybenzoyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(3-hydroxybenzoyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 115534948 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 2-[4-(3-hydroxybenzoyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cccc(O)c2)CCO1 |
| InChI | InChI=1S/C14H17NO5/c1-19-13(17)8-12-9-15(5-6-20-12)14(18)10-3-2-4-11(16)7-10/h2-4,7,12,16H,5-6,8-9H2,1H3 |
| InChIKey | DCEDQRXLYNWKGE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |