C14H18N2O4 — CID 79806162
methyl 2-[4-(5-methylpyridine-3-carbonyl)morpholin-2-yl]acetate (PubChem CID 79806162) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 2-[4-(5-methylpyridine-3-carbonyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(5-methylpyridine-3-carbonyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79806162 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 2-[4-(5-methylpyridine-3-carbonyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cncc(C)c2)CCO1 |
| InChI | InChI=1S/C14H18N2O4/c1-10-5-11(8-15-7-10)14(18)16-3-4-20-12(9-16)6-13(17)19-2/h5,7-8,12H,3-4,6,9H2,1-2H3 |
| InChIKey | HQBYXRDDZDMYRL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |