C13H14Cl2N2O4 — CID 79812705
methyl 2-[4-(5,6-dichloropyridine-3-carbonyl)morpholin-2-yl]acetate (PubChem CID 79812705) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is methyl 2-[4-(5,6-dichloropyridine-3-carbonyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(5,6-dichloropyridine-3-carbonyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79812705 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | methyl 2-[4-(5,6-dichloropyridine-3-carbonyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cnc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-20-11(18)5-9-7-17(2-3-21-9)13(19)8-4-10(14)12(15)16-6-8/h4,6,9H,2-3,5,7H2,1H3 |
| InChIKey | KXZZAHVUGCTWCJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|