C12H13Cl2NO3 — CID 81207977
(3,4-dichlorophenyl)-[2-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 81207977) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[2-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[2-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 81207977 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (3,4-dichlorophenyl)-[2-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCOC(CO)C1 |
| InChI | InChI=1S/C12H13Cl2NO3/c13-10-2-1-8(5-11(10)14)12(17)15-3-4-18-9(6-15)7-16/h1-2,5,9,16H,3-4,6-7H2 |
| InChIKey | QJOKVZHAIJGENX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |