C19H18Cl3N3O3 — CID 10114305
1-(4-chlorophenyl)-3-[[4-(3,4-dichlorobenzoyl)morpholin-2-yl]methyl]urea (PubChem CID 10114305) has the molecular formula C19H18Cl3N3O3 and a molecular weight of 442.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[4-(3,4-dichlorobenzoyl)morpholin-2-yl]methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[4-(3,4-dichlorobenzoyl)morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 10114305 |
| Molecular Formula | C19H18Cl3N3O3 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[4-(3,4-dichlorobenzoyl)morpholin-2-yl]methyl]urea |
| SMILES | O=C(NCC1CN(C(=O)c2ccc(Cl)c(Cl)c2)CCO1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl3N3O3/c20-13-2-4-14(5-3-13)24-19(27)23-10-15-11-25(7-8-28-15)18(26)12-1-6-16(21)17(22)9-12/h1-6,9,15H,7-8,10-11H2,(H2,23,24,27) |
| InChIKey | MZOYOSRKYQNISE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |