C12H17N3O3 — CID 113277915
[2-(aminomethyl)-4-pyridinyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 113277915) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is [2-(aminomethyl)-4-pyridinyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | [2-(aminomethyl)-4-pyridinyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 113277915 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [2-(aminomethyl)-4-pyridinyl]-[2-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | NCc1cc(C(=O)N2CCOC(CO)C2)ccn1 |
| InChI | InChI=1S/C12H17N3O3/c13-6-10-5-9(1-2-14-10)12(17)15-3-4-18-11(7-15)8-16/h1-2,5,11,16H,3-4,6-8,13H2 |
| InChIKey | HGHYRDBWFGFLFV-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |