C13H16N2O4 — CID 79806240
methyl 2-[4-(pyridine-3-carbonyl)morpholin-2-yl]acetate (PubChem CID 79806240) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 2-[4-(pyridine-3-carbonyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(pyridine-3-carbonyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79806240 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 2-[4-(pyridine-3-carbonyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cccnc2)CCO1 |
| InChI | InChI=1S/C13H16N2O4/c1-18-12(16)7-11-9-15(5-6-19-11)13(17)10-3-2-4-14-8-10/h2-4,8,11H,5-7,9H2,1H3 |
| InChIKey | CPWOEKPJSIQOIG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |