C14H15Cl2NO4 — CID 79812879
methyl 2-[4-(2,3-dichlorobenzoyl)morpholin-2-yl]acetate (PubChem CID 79812879) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is methyl 2-[4-(2,3-dichlorobenzoyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(2,3-dichlorobenzoyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 79812879 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | methyl 2-[4-(2,3-dichlorobenzoyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)c2cccc(Cl)c2Cl)CCO1 |
| InChI | InChI=1S/C14H15Cl2NO4/c1-20-12(18)7-9-8-17(5-6-21-9)14(19)10-3-2-4-11(15)13(10)16/h2-4,9H,5-8H2,1H3 |
| InChIKey | QJZSABZBKOZBNE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |