C19H22N2O2 — CID 42377336
[(2R)-2-(3-phenylpropyl)morpholin-4-yl]-pyridin-3-ylmethanone (PubChem CID 42377336) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(2R)-2-(3-phenylpropyl)morpholin-4-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2R)-2-(3-phenylpropyl)morpholin-4-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 42377336 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(2R)-2-(3-phenylpropyl)morpholin-4-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCO[C@H](CCCc2ccccc2)C1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(17-9-5-11-20-14-17)21-12-13-23-18(15-21)10-4-8-16-6-2-1-3-7-16/h1-3,5-7,9,11,14,18H,4,8,10,12-13,15H2/t18-/m1/s1 |
| InChIKey | JPTMJLFAKIWHLJ-GOSISDBHSA-N |
| XLogP | 2.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |