C19H27NO3 — CID 25292301
oxan-4-yl-[(2S)-2-(3-phenylpropyl)morpholin-4-yl]methanone (PubChem CID 25292301) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is oxan-4-yl-[(2S)-2-(3-phenylpropyl)morpholin-4-yl]methanone.
| Compound Name | oxan-4-yl-[(2S)-2-(3-phenylpropyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 25292301 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | oxan-4-yl-[(2S)-2-(3-phenylpropyl)morpholin-4-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CCO[C@@H](CCCc2ccccc2)C1 |
| InChI | InChI=1S/C19H27NO3/c21-19(17-9-12-22-13-10-17)20-11-14-23-18(15-20)8-4-7-16-5-2-1-3-6-16/h1-3,5-6,17-18H,4,7-15H2/t18-/m0/s1 |
| InChIKey | HKJBPSOVIMRRCY-SFHVURJKSA-N |
| XLogP | 2.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |