C19H21N3O2 — CID 97082335
[(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridin-3-ylmethanone (PubChem CID 97082335) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridin-3-ylmethanone.
| Compound Name | [(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97082335 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1C[C@H]2OCCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(16-7-4-8-20-11-16)22-13-17-18(14-22)24-10-9-21(17)12-15-5-2-1-3-6-15/h1-8,11,17-18H,9-10,12-14H2/t17-,18+/m0/s1 |
| InChIKey | NRTDYHYIYVSCDA-ZWKOTPCHSA-N |
| XLogP | 1.81 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |