C18H22N4O2 — CID 97066356
[(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-1H-pyrazol-4-yl)methanone (PubChem CID 97066356) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-1H-pyrazol-4-yl)methanone.
| Compound Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 97066356 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-1H-pyrazol-4-yl)methanone |
| SMILES | Cc1[nH]ncc1C(=O)N1C[C@@H]2[C@@H](C1)OCCN2Cc1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c1-13-15(9-19-20-13)18(23)22-11-16-17(12-22)24-8-7-21(16)10-14-5-3-2-4-6-14/h2-6,9,16-17H,7-8,10-12H2,1H3,(H,19,20)/t16-,17-/m1/s1 |
| InChIKey | PICQPLQYARJCFC-IAGOWNOFSA-N |
| XLogP | 1.44 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |