C18H20N4O2 — CID 98793047
[(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone (PubChem CID 98793047) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 98793047 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1C[C@@H]2[C@@H](C1)OCCN2Cc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2/c23-18(15-10-19-6-7-20-15)22-12-16-17(13-22)24-9-8-21(16)11-14-4-2-1-3-5-14/h1-7,10,16-17H,8-9,11-13H2/t16-,17-/m1/s1 |
| InChIKey | QSDODDLEAUSGME-IAGOWNOFSA-N |
| XLogP | 1.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |