C19H22N4O2 — CID 97082326
(4aS,7aS)-4-benzyl-N-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 97082326) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (4aS,7aS)-4-benzyl-N-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aS,7aS)-4-benzyl-N-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 97082326 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (4aS,7aS)-4-benzyl-N-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | O=C(Nc1ccccn1)N1C[C@@H]2OCCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C19H22N4O2/c24-19(21-18-8-4-5-9-20-18)23-13-16-17(14-23)25-11-10-22(16)12-15-6-2-1-3-7-15/h1-9,16-17H,10-14H2,(H,20,21,24)/t16-,17-/m0/s1 |
| InChIKey | IBTQEKHFLFLAOM-IRXDYDNUSA-N |
| XLogP | 2.20 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |