C19H22N2O2S — CID 97015555
1-[(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-thiophen-2-ylethanone (PubChem CID 97015555) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 97015555 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[(4aS,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1C[C@H]2OCCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C19H22N2O2S/c22-19(11-16-7-4-10-24-16)21-13-17-18(14-21)23-9-8-20(17)12-15-5-2-1-3-6-15/h1-7,10,17-18H,8-9,11-14H2/t17-,18+/m0/s1 |
| InChIKey | JFFAAUVXYVSQOA-ZWKOTPCHSA-N |
| XLogP | 2.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |