C22H23N3O3S — CID 97002453
[(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 97002453) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is [(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 97002453 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [(4aS,7aS)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1oc(-c2cccs2)nc1C(=O)N1C[C@@H]2OCCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15-20(23-21(28-15)19-8-5-11-29-19)22(26)25-13-17-18(14-25)27-10-9-24(17)12-16-6-3-2-4-7-16/h2-8,11,17-18H,9-10,12-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | IXKFTJXLSYBEFJ-ROUUACIJSA-N |
| XLogP | 3.44 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |