C17H21N3O2S — CID 95589955
[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone (PubChem CID 95589955) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 95589955 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1oc(-c2cccs2)nc1C(=O)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C17H21N3O2S/c1-12-15(18-16(22-12)14-6-4-10-23-14)17(21)20-9-8-19-7-3-2-5-13(19)11-20/h4,6,10,13H,2-3,5,7-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | JSRYWXRZLQWVMP-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |