C18H23N3OS — CID 95589892
[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone (PubChem CID 95589892) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone.
| Compound Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 95589892 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone |
| SMILES | O=C(c1cccn1Cc1cccs1)N1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H23N3OS/c22-18(21-11-10-19-8-2-1-5-15(19)13-21)17-7-3-9-20(17)14-16-6-4-12-23-16/h3-4,6-7,9,12,15H,1-2,5,8,10-11,13-14H2/t15-/m0/s1 |
| InChIKey | UHNIGLAAKBGABA-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |